C30H38FN3O — CID 138618459
4-[3-[4-(4-cyclopentyl-5-fluoro-2-methyl-1,3-dihydroisoquinolin-4-yl)piperidin-1-yl]propoxy]benzonitrile (PubChem CID 138618459) has the molecular formula C30H38FN3O and a molecular weight of 475.65 g/mol. Its IUPAC name is 4-[3-[4-(4-cyclopentyl-5-fluoro-2-methyl-1,3-dihydroisoquinolin-4-yl)piperidin-1-yl]propoxy]benzonitrile.
| Compound Name | 4-[3-[4-(4-cyclopentyl-5-fluoro-2-methyl-1,3-dihydroisoquinolin-4-yl)piperidin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 138618459 |
| Molecular Formula | C30H38FN3O |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | 4-[3-[4-(4-cyclopentyl-5-fluoro-2-methyl-1,3-dihydroisoquinolin-4-yl)piperidin-1-yl]propoxy]benzonitrile |
| SMILES | CN1Cc2cccc(F)c2C(C2CCCC2)(C2CCN(CCCOc3ccc(C#N)cc3)CC2)C1 |
| InChI | InChI=1S/C30H38FN3O/c1-33-21-24-6-4-9-28(31)29(24)30(22-33,25-7-2-3-8-25)26-14-17-34(18-15-26)16-5-19-35-27-12-10-23(20-32)11-13-27/h4,6,9-13,25-26H,2-3,5,7-8,14-19,21-22H2,1H3 |
| InChIKey | ODUBSMHAIJIEOB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|