C31H42N4O — CID 166724079
4-[3-[4-[2-methyl-4-(1-methylpiperidin-2-yl)-1,3-dihydroisoquinolin-4-yl]piperidin-1-yl]propoxy]benzonitrile (PubChem CID 166724079) has the molecular formula C31H42N4O and a molecular weight of 486.70 g/mol. Its IUPAC name is 4-[3-[4-[2-methyl-4-(1-methylpiperidin-2-yl)-1,3-dihydroisoquinolin-4-yl]piperidin-1-yl]propoxy]benzonitrile.
| Compound Name | 4-[3-[4-[2-methyl-4-(1-methylpiperidin-2-yl)-1,3-dihydroisoquinolin-4-yl]piperidin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 166724079 |
| Molecular Formula | C31H42N4O |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | 4-[3-[4-[2-methyl-4-(1-methylpiperidin-2-yl)-1,3-dihydroisoquinolin-4-yl]piperidin-1-yl]propoxy]benzonitrile |
| SMILES | CN1Cc2ccccc2C(C2CCN(CCCOc3ccc(C#N)cc3)CC2)(C2CCCCN2C)C1 |
| InChI | InChI=1S/C31H42N4O/c1-33-23-26-8-3-4-9-29(26)31(24-33,30-10-5-6-17-34(30)2)27-15-19-35(20-16-27)18-7-21-36-28-13-11-25(22-32)12-14-28/h3-4,8-9,11-14,27,30H,5-7,10,15-21,23-24H2,1-2H3 |
| InChIKey | ZEKWARPXBLITSF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 42.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|