C32H43N3O4 — CID 145397279
methyl 4-[1-[3-(4-cyanophenoxy)propyl]piperidin-4-yl]-4-(2-methoxypentyl)-1,3-dihydroisoquinoline-2-carboxylate (PubChem CID 145397279) has the molecular formula C32H43N3O4 and a molecular weight of 533.71 g/mol. Its IUPAC name is methyl 4-[1-[3-(4-cyanophenoxy)propyl]piperidin-4-yl]-4-(2-methoxypentyl)-1,3-dihydroisoquinoline-2-carboxylate.
| Compound Name | methyl 4-[1-[3-(4-cyanophenoxy)propyl]piperidin-4-yl]-4-(2-methoxypentyl)-1,3-dihydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 145397279 |
| Molecular Formula | C32H43N3O4 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | methyl 4-[1-[3-(4-cyanophenoxy)propyl]piperidin-4-yl]-4-(2-methoxypentyl)-1,3-dihydroisoquinoline-2-carboxylate |
| SMILES | CCCC(CC1(C2CCN(CCCOc3ccc(C#N)cc3)CC2)CN(C(=O)OC)Cc2ccccc21)OC |
| InChI | InChI=1S/C32H43N3O4/c1-4-8-29(37-2)21-32(24-35(31(36)38-3)23-26-9-5-6-10-30(26)32)27-15-18-34(19-16-27)17-7-20-39-28-13-11-25(22-33)12-14-28/h5-6,9-14,27,29H,4,7-8,15-21,23-24H2,1-3H3 |
| InChIKey | HMSWMBYKFFYRBI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 75.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|