C31H42N2O — CID 157164492
4-[1-(2-ethylbutyl)-3,4-dihydro-2H-naphthalen-1-yl]-1-[3-(4-isocyanophenoxy)propyl]piperidine (PubChem CID 157164492) has the molecular formula C31H42N2O and a molecular weight of 458.69 g/mol. Its IUPAC name is 4-[1-(2-ethylbutyl)-3,4-dihydro-2H-naphthalen-1-yl]-1-[3-(4-isocyanophenoxy)propyl]piperidine.
| Compound Name | 4-[1-(2-ethylbutyl)-3,4-dihydro-2H-naphthalen-1-yl]-1-[3-(4-isocyanophenoxy)propyl]piperidine |
|---|---|
| PubChem CID | 157164492 |
| Molecular Formula | C31H42N2O |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | 4-[1-(2-ethylbutyl)-3,4-dihydro-2H-naphthalen-1-yl]-1-[3-(4-isocyanophenoxy)propyl]piperidine |
| SMILES | [C-]#[N+]c1ccc(OCCCN2CCC(C3(CC(CC)CC)CCCc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C31H42N2O/c1-4-25(5-2)24-31(19-8-11-26-10-6-7-12-30(26)31)27-17-21-33(22-18-27)20-9-23-34-29-15-13-28(32-3)14-16-29/h6-7,10,12-16,25,27H,4-5,8-9,11,17-24H2,1-2H3 |
| InChIKey | AMTFBICUIGPTQY-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 16.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|