C29H36N2O — CID 159929467
3-(1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)-1-[3-(4-isocyanophenoxy)propyl]pyrrolidine (PubChem CID 159929467) has the molecular formula C29H36N2O and a molecular weight of 428.62 g/mol. Its IUPAC name is 3-(1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)-1-[3-(4-isocyanophenoxy)propyl]pyrrolidine.
| Compound Name | 3-(1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)-1-[3-(4-isocyanophenoxy)propyl]pyrrolidine |
|---|---|
| PubChem CID | 159929467 |
| Molecular Formula | C29H36N2O |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 3-(1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)-1-[3-(4-isocyanophenoxy)propyl]pyrrolidine |
| SMILES | [C-]#[N+]c1ccc(OCCCN2CCC(C3(C4CCCC4)CCCc4ccccc43)C2)cc1 |
| InChI | InChI=1S/C29H36N2O/c1-30-26-13-15-27(16-14-26)32-21-7-19-31-20-17-25(22-31)29(24-10-3-4-11-24)18-6-9-23-8-2-5-12-28(23)29/h2,5,8,12-16,24-25H,3-4,6-7,9-11,17-22H2 |
| InChIKey | NZLLGXFDTZLPOX-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 16.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|