C31H37N3 — CID 158891386
5-[2-[4-(1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)piperidin-1-yl]ethyl]-2-isocyano-1H-indole (PubChem CID 158891386) has the molecular formula C31H37N3 and a molecular weight of 451.66 g/mol. Its IUPAC name is 5-[2-[4-(1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)piperidin-1-yl]ethyl]-2-isocyano-1H-indole.
| Compound Name | 5-[2-[4-(1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)piperidin-1-yl]ethyl]-2-isocyano-1H-indole |
|---|---|
| PubChem CID | 158891386 |
| Molecular Formula | C31H37N3 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | 5-[2-[4-(1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)piperidin-1-yl]ethyl]-2-isocyano-1H-indole |
| SMILES | [C-]#[N+]c1cc2cc(CCN3CCC(C4(C5CCCC5)CCCc5ccccc54)CC3)ccc2[nH]1 |
| InChI | InChI=1S/C31H37N3/c1-32-30-22-25-21-23(12-13-29(25)33-30)14-18-34-19-15-27(16-20-34)31(26-9-3-4-10-26)17-6-8-24-7-2-5-11-28(24)31/h2,5,7,11-13,21-22,26-27,33H,3-4,6,8-10,14-20H2 |
| InChIKey | JEGYCKCUMHCXIP-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 23.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|