C28H35N3O2S — CID 166724363
4-[3-[4-[1-(1-oxothiolan-2-yl)-3,4-dihydro-2H-isoquinolin-1-yl]piperidin-1-yl]propoxy]benzonitrile (PubChem CID 166724363) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is 4-[3-[4-[1-(1-oxothiolan-2-yl)-3,4-dihydro-2H-isoquinolin-1-yl]piperidin-1-yl]propoxy]benzonitrile.
| Compound Name | 4-[3-[4-[1-(1-oxothiolan-2-yl)-3,4-dihydro-2H-isoquinolin-1-yl]piperidin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 166724363 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 4-[3-[4-[1-(1-oxothiolan-2-yl)-3,4-dihydro-2H-isoquinolin-1-yl]piperidin-1-yl]propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCCN2CCC(C3(C4CCCS4=O)NCCc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C28H35N3O2S/c29-21-22-8-10-25(11-9-22)33-19-4-16-31-17-13-24(14-18-31)28(27-7-3-20-34(27)32)26-6-2-1-5-23(26)12-15-30-28/h1-2,5-6,8-11,24,27,30H,3-4,7,12-20H2 |
| InChIKey | YUZCSIGYBQAFSV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|