C32H43N3O4 — CID 145397436
methanol;methyl 4-[1-[3-(4-cyanophenoxy)propyl]piperidin-4-yl]-4-cyclopentyl-1,3-dihydroisoquinoline-2-carboxylate (PubChem CID 145397436) has the molecular formula C32H43N3O4 and a molecular weight of 533.71 g/mol. Its IUPAC name is methanol;methyl 4-[1-[3-(4-cyanophenoxy)propyl]piperidin-4-yl]-4-cyclopentyl-1,3-dihydroisoquinoline-2-carboxylate.
| Compound Name | methanol;methyl 4-[1-[3-(4-cyanophenoxy)propyl]piperidin-4-yl]-4-cyclopentyl-1,3-dihydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 145397436 |
| Molecular Formula | C32H43N3O4 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | methanol;methyl 4-[1-[3-(4-cyanophenoxy)propyl]piperidin-4-yl]-4-cyclopentyl-1,3-dihydroisoquinoline-2-carboxylate |
| SMILES | CO.COC(=O)N1Cc2ccccc2C(C2CCCC2)(C2CCN(CCCOc3ccc(C#N)cc3)CC2)C1 |
| InChI | InChI=1S/C31H39N3O3.CH4O/c1-36-30(35)34-22-25-7-2-5-10-29(25)31(23-34,26-8-3-4-9-26)27-15-18-33(19-16-27)17-6-20-37-28-13-11-24(21-32)12-14-28;1-2/h2,5,7,10-14,26-27H,3-4,6,8-9,15-20,22-23H2,1H3;2H,1H3 |
| InChIKey | YZFZHSMQBCZQLZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|