C23H25FN6O — CID 138648210
4-[2-[[2-(2-fluoro-3H-azepin-3-yl)-8-methyl-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol (PubChem CID 138648210) has the molecular formula C23H25FN6O and a molecular weight of 420.49 g/mol. Its IUPAC name is 4-[2-[[2-(2-fluoro-3H-azepin-3-yl)-8-methyl-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-(2-fluoro-3H-azepin-3-yl)-8-methyl-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 138648210 |
| Molecular Formula | C23H25FN6O |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-[2-[[2-(2-fluoro-3H-azepin-3-yl)-8-methyl-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol |
| SMILES | Cc1nc2c(NCCc3ccc(O)cc3)nc(C3C=CC=CN=C3F)nc2n1C(C)C |
| InChI | InChI=1S/C23H25FN6O/c1-14(2)30-15(3)27-19-22(26-13-11-16-7-9-17(31)10-8-16)28-21(29-23(19)30)18-6-4-5-12-25-20(18)24/h4-10,12,14,18,31H,11,13H2,1-3H3,(H,26,28,29) |
| InChIKey | SPKTXXLEFXIPJJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |