C21H18F3NO4S — CID 138658679
4-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid (PubChem CID 138658679) has the molecular formula C21H18F3NO4S and a molecular weight of 437.44 g/mol. Its IUPAC name is 4-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid.
| Compound Name | 4-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 138658679 |
| Molecular Formula | C21H18F3NO4S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 4-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1H-pyrrolo[1,2-a]indole-2-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(Cc2c3n(c4ccccc24)CC(C(=O)O)C3)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F3NO4S/c1-30(28,29)14-7-6-12(17(10-14)21(22,23)24)8-16-15-4-2-3-5-18(15)25-11-13(20(26)27)9-19(16)25/h2-7,10,13H,8-9,11H2,1H3,(H,26,27) |
| InChIKey | QKFCEHDZLGMHFM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|