C21H29N3O4 — CID 138670582
5-[(E)-2-[4-[2-hydroxyethyl-[2-[3-hydroxy-2-(methylamino)propoxy]ethyl]amino]phenyl]ethenyl]-1H-pyridin-2-one (PubChem CID 138670582) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 5-[(E)-2-[4-[2-hydroxyethyl-[2-[3-hydroxy-2-(methylamino)propoxy]ethyl]amino]phenyl]ethenyl]-1H-pyridin-2-one.
| Compound Name | 5-[(E)-2-[4-[2-hydroxyethyl-[2-[3-hydroxy-2-(methylamino)propoxy]ethyl]amino]phenyl]ethenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 138670582 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 5-[(E)-2-[4-[2-hydroxyethyl-[2-[3-hydroxy-2-(methylamino)propoxy]ethyl]amino]phenyl]ethenyl]-1H-pyridin-2-one |
| SMILES | CNC(CO)COCCN(CCO)c1ccc(/C=C/c2ccc(=O)[nH]c2)cc1 |
| InChI | InChI=1S/C21H29N3O4/c1-22-19(15-26)16-28-13-11-24(10-12-25)20-7-4-17(5-8-20)2-3-18-6-9-21(27)23-14-18/h2-9,14,19,22,25-26H,10-13,15-16H2,1H3,(H,23,27)/b3-2+ |
| InChIKey | ANLBHXADGVSBPY-NSCUHMNNSA-N |
| XLogP | 0.94 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|