C10H24ClNO6 — CID 138673415
2-hydroxyethyl(trimethyl)azanium;2,3,4,5-tetrahydroxypentanal;chloride (PubChem CID 138673415) has the molecular formula C10H24ClNO6 and a molecular weight of 289.76 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;2,3,4,5-tetrahydroxypentanal;chloride.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;2,3,4,5-tetrahydroxypentanal;chloride |
|---|---|
| PubChem CID | 138673415 |
| Molecular Formula | C10H24ClNO6 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;2,3,4,5-tetrahydroxypentanal;chloride |
| SMILES | C[N+](C)(C)CCO.O=CC(O)C(O)C(O)CO.[Cl-] |
| InChI | InChI=1S/C5H14NO.C5H10O5.ClH/c1-6(2,3)4-5-7;6-1-3(8)5(10)4(9)2-7;/h7H,4-5H2,1-3H3;1,3-5,7-10H,2H2;1H/q+1;;/p-1 |
| InChIKey | MCVLPYLQZPIGAL-UHFFFAOYSA-M |
| XLogP | -6.05 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | -6.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|