C42H45N3O9S2 — CID 138679635
[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl] N-[2-[(tert-butyldisulfanyl)methyl]phenyl]carbamate (PubChem CID 138679635) has the molecular formula C42H45N3O9S2 and a molecular weight of 799.97 g/mol. Its IUPAC name is [5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl] N-[2-[(tert-butyldisulfanyl)methyl]phenyl]carbamate.
| Compound Name | [5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl] N-[2-[(tert-butyldisulfanyl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 138679635 |
| Molecular Formula | C42H45N3O9S2 |
| Molecular Weight | 799.97 g/mol |
| Exact Mass | 799.26 |
| IUPAC Name | [5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl] N-[2-[(tert-butyldisulfanyl)methyl]phenyl]carbamate |
| SMILES | COc1ccc(C(OCC2OC(n3ccc(=O)[nH]c3=O)C(OC(=O)Nc3ccccc3CSSC(C)(C)C)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H45N3O9S2/c1-41(2,3)56-55-26-27-11-9-10-14-33(27)43-40(49)54-37-36(47)34(53-38(37)45-24-23-35(46)44-39(45)48)25-52-42(28-12-7-6-8-13-28,29-15-19-31(50-4)20-16-29)30-17-21-32(51-5)22-18-30/h6-24,34,36-38,47H,25-26H2,1-5H3,(H,43,49)(H,44,46,48) |
| InChIKey | YIKTVEHLPQLMKR-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.97 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|