C9H12N2O3S2 — CID 138692175
ethyl 4-[bis(methylsulfanyl)methylideneamino]-1,3-oxazole-2-carboxylate (PubChem CID 138692175) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is ethyl 4-[bis(methylsulfanyl)methylideneamino]-1,3-oxazole-2-carboxylate.
| Compound Name | ethyl 4-[bis(methylsulfanyl)methylideneamino]-1,3-oxazole-2-carboxylate |
|---|---|
| PubChem CID | 138692175 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | ethyl 4-[bis(methylsulfanyl)methylideneamino]-1,3-oxazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(N=C(SC)SC)co1 |
| InChI | InChI=1S/C9H12N2O3S2/c1-4-13-8(12)7-10-6(5-14-7)11-9(15-2)16-3/h5H,4H2,1-3H3 |
| InChIKey | SNWSFEQUPNAPHW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|