C21H17N3O4S — CID 138693509
[2-(1,3-dioxoisoindol-2-yl)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamic acid (PubChem CID 138693509) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is [2-(1,3-dioxoisoindol-2-yl)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamic acid.
| Compound Name | [2-(1,3-dioxoisoindol-2-yl)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 138693509 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [2-(1,3-dioxoisoindol-2-yl)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamic acid |
| SMILES | Cc1ncsc1-c1ccc(C(CN2C(=O)c3ccccc3C2=O)NC(=O)O)cc1 |
| InChI | InChI=1S/C21H17N3O4S/c1-12-18(29-11-22-12)14-8-6-13(7-9-14)17(23-21(27)28)10-24-19(25)15-4-2-3-5-16(15)20(24)26/h2-9,11,17,23H,10H2,1H3,(H,27,28) |
| InChIKey | FDOBTYQTYUVZTC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|