C14H14F2N2O2S — CID 138696488
7,8-difluoro-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one (PubChem CID 138696488) has the molecular formula C14H14F2N2O2S and a molecular weight of 312.34 g/mol. Its IUPAC name is 7,8-difluoro-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one.
| Compound Name | 7,8-difluoro-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 138696488 |
| Molecular Formula | C14H14F2N2O2S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 7,8-difluoro-2-(oxan-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CSC2CCOCC2)nc2c(F)c(F)ccc12 |
| InChI | InChI=1S/C14H14F2N2O2S/c15-10-2-1-9-13(12(10)16)17-11(18-14(9)19)7-21-8-3-5-20-6-4-8/h1-2,8H,3-7H2,(H,17,18,19) |
| InChIKey | ZEMVMUHHJYFVFX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |