C25H26O6 — CID 138706883
2-[4-[(E)-1-hydroxy-3-[4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoxy]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 138706883) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[4-[(E)-1-hydroxy-3-[4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoxy]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[(E)-1-hydroxy-3-[4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoxy]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138706883 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[4-[(E)-1-hydroxy-3-[4-(2-methylprop-2-enoyloxy)phenyl]prop-2-enoxy]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccc(OC(O)/C=C/c2ccc(OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C25H26O6/c1-17(2)24(27)29-16-15-20-7-10-21(11-8-20)30-23(26)14-9-19-5-12-22(13-6-19)31-25(28)18(3)4/h5-14,23,26H,1,3,15-16H2,2,4H3/b14-9+ |
| InChIKey | LONOWYJIVCLSKU-NTEUORMPSA-N |
| XLogP | 4.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|