C21H19BrN2O4 — CID 138732804
(E,2R)-2-(4-bromophenyl)-5-cyano-4-methyl-2-(phenylmethoxycarbonylamino)pent-4-enoic acid (PubChem CID 138732804) has the molecular formula C21H19BrN2O4 and a molecular weight of 443.30 g/mol. Its IUPAC name is (E,2R)-2-(4-bromophenyl)-5-cyano-4-methyl-2-(phenylmethoxycarbonylamino)pent-4-enoic acid.
| Compound Name | (E,2R)-2-(4-bromophenyl)-5-cyano-4-methyl-2-(phenylmethoxycarbonylamino)pent-4-enoic acid |
|---|---|
| PubChem CID | 138732804 |
| Molecular Formula | C21H19BrN2O4 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | (E,2R)-2-(4-bromophenyl)-5-cyano-4-methyl-2-(phenylmethoxycarbonylamino)pent-4-enoic acid |
| SMILES | C/C(=C\C#N)C[C@](NC(=O)OCc1ccccc1)(C(=O)O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrN2O4/c1-15(11-12-23)13-21(19(25)26,17-7-9-18(22)10-8-17)24-20(27)28-14-16-5-3-2-4-6-16/h2-11H,13-14H2,1H3,(H,24,27)(H,25,26)/b15-11+/t21-/m1/s1 |
| InChIKey | KEVWSMVBQBABFE-RKZJEGACSA-N |
| XLogP | 4.52 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|