C28H24N2O5P+ — CID 67006644
benzyl N-[(4-cyanophenyl)-diphenylmethyl]carbamate;dihydroxy(oxo)phosphanium (PubChem CID 67006644) has the molecular formula C28H24N2O5P+ and a molecular weight of 499.48 g/mol. Its IUPAC name is benzyl N-[(4-cyanophenyl)-diphenylmethyl]carbamate;dihydroxy(oxo)phosphanium.
| Compound Name | benzyl N-[(4-cyanophenyl)-diphenylmethyl]carbamate;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 67006644 |
| Molecular Formula | C28H24N2O5P+ |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | benzyl N-[(4-cyanophenyl)-diphenylmethyl]carbamate;dihydroxy(oxo)phosphanium |
| SMILES | N#Cc1ccc(C(NC(=O)OCc2ccccc2)(c2ccccc2)c2ccccc2)cc1.O=[P+](O)O |
| InChI | InChI=1S/C28H22N2O2.HO3P/c29-20-22-16-18-26(19-17-22)28(24-12-6-2-7-13-24,25-14-8-3-9-15-25)30-27(31)32-21-23-10-4-1-5-11-23;1-4(2)3/h1-19H,21H2,(H,30,31);(H-,1,2,3)/p+1 |
| InChIKey | WTLOSOLUQUAVEX-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|