C27H26N2O4 — CID 90912893
benzyl N-[1-[4-(4-cyanophenyl)phenyl]-2-(3-methoxyoxiran-2-yl)propan-2-yl]carbamate (PubChem CID 90912893) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is benzyl N-[1-[4-(4-cyanophenyl)phenyl]-2-(3-methoxyoxiran-2-yl)propan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[4-(4-cyanophenyl)phenyl]-2-(3-methoxyoxiran-2-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 90912893 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | benzyl N-[1-[4-(4-cyanophenyl)phenyl]-2-(3-methoxyoxiran-2-yl)propan-2-yl]carbamate |
| SMILES | COC1OC1C(C)(Cc1ccc(-c2ccc(C#N)cc2)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H26N2O4/c1-27(24-25(31-2)33-24,29-26(30)32-18-21-6-4-3-5-7-21)16-19-8-12-22(13-9-19)23-14-10-20(17-28)11-15-23/h3-15,24-25H,16,18H2,1-2H3,(H,29,30) |
| InChIKey | ZWPFIOCLCZIASM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|