C19H20N6O3 — CID 138734869
5-amino-1-[(3S)-1-cyanopyrrolidin-3-yl]-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazole-4-carboxamide (PubChem CID 138734869) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 5-amino-1-[(3S)-1-cyanopyrrolidin-3-yl]-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-[(3S)-1-cyanopyrrolidin-3-yl]-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138734869 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 5-amino-1-[(3S)-1-cyanopyrrolidin-3-yl]-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazole-4-carboxamide |
| SMILES | COc1cc(C#Cc2nn([C@H]3CCN(C#N)C3)c(N)c2C(N)=O)cc(OC)c1 |
| InChI | InChI=1S/C19H20N6O3/c1-27-14-7-12(8-15(9-14)28-2)3-4-16-17(19(22)26)18(21)25(23-16)13-5-6-24(10-13)11-20/h7-9,13H,5-6,10,21H2,1-2H3,(H2,22,26)/t13-/m0/s1 |
| InChIKey | DHPILJOVCXZYNN-ZDUSSCGKSA-N |
| XLogP | 0.71 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|