C6H8N4O3 — CID 138747923
(7S)-7-hydroxy-4-oxa-2,6,9,11-tetrazatricyclo[6.3.0.03,5]undec-1(8)-en-10-one (PubChem CID 138747923) has the molecular formula C6H8N4O3 and a molecular weight of 184.16 g/mol. Its IUPAC name is (7S)-7-hydroxy-4-oxa-2,6,9,11-tetrazatricyclo[6.3.0.03,5]undec-1(8)-en-10-one.
| Compound Name | (7S)-7-hydroxy-4-oxa-2,6,9,11-tetrazatricyclo[6.3.0.03,5]undec-1(8)-en-10-one |
|---|---|
| PubChem CID | 138747923 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (7S)-7-hydroxy-4-oxa-2,6,9,11-tetrazatricyclo[6.3.0.03,5]undec-1(8)-en-10-one |
| SMILES | O=c1[nH]c2c([nH]1)[C@H](O)NC1OC1N2 |
| InChI | InChI=1S/C6H8N4O3/c11-3-1-2(9-6(12)7-1)8-4-5(10-3)13-4/h3-5,8,10-11H,(H2,7,9,12)/t3-,4?,5?/m0/s1 |
| InChIKey | BJLSHDLNICDOLJ-KLFYCJEISA-N |
| XLogP | -1.61 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|