C5H7N5O2 — CID 133057029
2-amino-6-hydroxy-3,6,7,9-tetrahydropurin-8-one (PubChem CID 133057029) has the molecular formula C5H7N5O2 and a molecular weight of 169.14 g/mol. Its IUPAC name is 2-amino-6-hydroxy-3,6,7,9-tetrahydropurin-8-one.
| Compound Name | 2-amino-6-hydroxy-3,6,7,9-tetrahydropurin-8-one |
|---|---|
| PubChem CID | 133057029 |
| Molecular Formula | C5H7N5O2 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 2-amino-6-hydroxy-3,6,7,9-tetrahydropurin-8-one |
| SMILES | NC1=NC(O)c2[nH]c(=O)[nH]c2N1 |
| InChI | InChI=1S/C5H7N5O2/c6-4-8-2-1(3(11)10-4)7-5(12)9-2/h3,11H,(H3,6,8,10)(H2,7,9,12) |
| InChIKey | BVEHSUVSGVXQAG-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |