C12H17N5O4 — CID 89381180
2-amino-5-[[(3,4-dihydroxy-6-oxabicyclo[3.1.0]hexan-2-yl)amino]methyl]-3,4a,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 89381180) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-amino-5-[[(3,4-dihydroxy-6-oxabicyclo[3.1.0]hexan-2-yl)amino]methyl]-3,4a,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-[[(3,4-dihydroxy-6-oxabicyclo[3.1.0]hexan-2-yl)amino]methyl]-3,4a,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 89381180 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-amino-5-[[(3,4-dihydroxy-6-oxabicyclo[3.1.0]hexan-2-yl)amino]methyl]-3,4a,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | NC1=NC2NC=C(CNC3C(O)C(O)C4OC34)C2C(=O)N1 |
| InChI | InChI=1S/C12H17N5O4/c13-12-16-10-4(11(20)17-12)3(2-15-10)1-14-5-6(18)7(19)9-8(5)21-9/h2,4-10,14-15,18-19H,1H2,(H3,13,16,17,20) |
| InChIKey | QQDMJZXNQMUUFW-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|