C36H39NO5S — CID 138963192
methyl (3S,12S,13S)-12-hydroxy-5-(4-methylphenyl)sulfonyl-13-phenyl-5-azahexacyclo[15.3.1.115,19.01,14.03,12.06,11]docosa-6,8,10-triene-3-carboxylate (PubChem CID 138963192) has the molecular formula C36H39NO5S and a molecular weight of 597.78 g/mol. Its IUPAC name is methyl (3S,12S,13S)-12-hydroxy-5-(4-methylphenyl)sulfonyl-13-phenyl-5-azahexacyclo[15.3.1.115,19.01,14.03,12.06,11]docosa-6,8,10-triene-3-carboxylate.
| Compound Name | methyl (3S,12S,13S)-12-hydroxy-5-(4-methylphenyl)sulfonyl-13-phenyl-5-azahexacyclo[15.3.1.115,19.01,14.03,12.06,11]docosa-6,8,10-triene-3-carboxylate |
|---|---|
| PubChem CID | 138963192 |
| Molecular Formula | C36H39NO5S |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | methyl (3S,12S,13S)-12-hydroxy-5-(4-methylphenyl)sulfonyl-13-phenyl-5-azahexacyclo[15.3.1.115,19.01,14.03,12.06,11]docosa-6,8,10-triene-3-carboxylate |
| SMILES | COC(=O)[C@@]12CN(S(=O)(=O)c3ccc(C)cc3)c3ccccc3[C@@]1(O)[C@H](c1ccccc1)C1C3CC4CC(C3)CC1(C4)C2 |
| InChI | InChI=1S/C36H39NO5S/c1-23-12-14-28(15-13-23)43(40,41)37-22-35(33(38)42-2)21-34-19-24-16-25(20-34)18-27(17-24)31(34)32(26-8-4-3-5-9-26)36(35,39)29-10-6-7-11-30(29)37/h3-15,24-25,27,31-32,39H,16-22H2,1-2H3/t24?,25?,27?,31?,32-,34?,35-,36-/m1/s1 |
| InChIKey | KNRMDEWIFPTYIM-FMKUMOIHSA-N |
| XLogP | 6.18 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |