C18H18O3 — CID 138972034
(2S)-2-ethynyl-5-methoxy-2-pent-4-enoyl-3,4-dihydronaphthalen-1-one (PubChem CID 138972034) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2S)-2-ethynyl-5-methoxy-2-pent-4-enoyl-3,4-dihydronaphthalen-1-one.
| Compound Name | (2S)-2-ethynyl-5-methoxy-2-pent-4-enoyl-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 138972034 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (2S)-2-ethynyl-5-methoxy-2-pent-4-enoyl-3,4-dihydronaphthalen-1-one |
| SMILES | C#C[C@]1(C(=O)CCC=C)CCc2c(OC)cccc2C1=O |
| InChI | InChI=1S/C18H18O3/c1-4-6-10-16(19)18(5-2)12-11-13-14(17(18)20)8-7-9-15(13)21-3/h2,4,7-9H,1,6,10-12H2,3H3/t18-/m1/s1 |
| InChIKey | KQGUQNZMRAXVFM-GOSISDBHSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|