C20H37IO2Si — CID 138977130
(4S,5E,7S,8R,9E)-7-ethyl-10-iodo-5,9-dimethyl-8-triethylsilyloxydeca-1,5,9-trien-4-ol (PubChem CID 138977130) has the molecular formula C20H37IO2Si and a molecular weight of 464.50 g/mol. Its IUPAC name is (4S,5E,7S,8R,9E)-7-ethyl-10-iodo-5,9-dimethyl-8-triethylsilyloxydeca-1,5,9-trien-4-ol.
| Compound Name | (4S,5E,7S,8R,9E)-7-ethyl-10-iodo-5,9-dimethyl-8-triethylsilyloxydeca-1,5,9-trien-4-ol |
|---|---|
| PubChem CID | 138977130 |
| Molecular Formula | C20H37IO2Si |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (4S,5E,7S,8R,9E)-7-ethyl-10-iodo-5,9-dimethyl-8-triethylsilyloxydeca-1,5,9-trien-4-ol |
| SMILES | C=CC[C@H](O)/C(C)=C/[C@H](CC)[C@@H](O[Si](CC)(CC)CC)/C(C)=C/I |
| InChI | InChI=1S/C20H37IO2Si/c1-8-13-19(22)16(6)14-18(9-2)20(17(7)15-21)23-24(10-3,11-4)12-5/h8,14-15,18-20,22H,1,9-13H2,2-7H3/b16-14+,17-15+/t18-,19-,20-/m0/s1 |
| InChIKey | VIJJGZSPAFIVJO-MXSLJCGYSA-N |
| XLogP | 6.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|