C29H16N2O6 — CID 138982804
2',7'-dinitrospiro[1,3-dihydroindeno[5,6-g]naphthalene-2,9'-fluorene]-6,9-dione (PubChem CID 138982804) has the molecular formula C29H16N2O6 and a molecular weight of 488.46 g/mol. Its IUPAC name is 2',7'-dinitrospiro[1,3-dihydroindeno[5,6-g]naphthalene-2,9'-fluorene]-6,9-dione.
| Compound Name | 2',7'-dinitrospiro[1,3-dihydroindeno[5,6-g]naphthalene-2,9'-fluorene]-6,9-dione |
|---|---|
| PubChem CID | 138982804 |
| Molecular Formula | C29H16N2O6 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 2',7'-dinitrospiro[1,3-dihydroindeno[5,6-g]naphthalene-2,9'-fluorene]-6,9-dione |
| SMILES | O=C1C=CC(=O)c2cc3cc4c(cc3cc21)CC1(C4)c2cc([N+](=O)[O-])ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C29H16N2O6/c32-27-5-6-28(33)24-10-16-8-18-14-29(13-17(18)7-15(16)9-23(24)27)25-11-19(30(34)35)1-3-21(25)22-4-2-20(31(36)37)12-26(22)29/h1-12H,13-14H2 |
| InChIKey | XVMCSKIPCXLQKL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|