About CID 138984815
CID 138984815 (PubChem CID 138984815) has the molecular formula C8H7O2
and a molecular weight of 135.14 g/mol.
Molecular Properties
| Compound Name | CID 138984815 |
| PubChem CID | 138984815 |
| Molecular Formula | C8H7O2 |
| Molecular Weight | 135.14 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | — |
| SMILES | O[C]1OCc2ccccc21 |
| InChI | InChI=1S/C8H7O2/c9-8-7-4-2-1-3-6(7)5-10-8/h1-4,9H,5H2 |
| InChIKey | AEGHZFPHCOLRKR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.14 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 138984815 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138984815?
The IUPAC name of CID 138984815 (CID 138984815) is not available.
What is the SMILES notation for CID 138984815?
The canonical SMILES for CID 138984815 is O[C]1OCc2ccccc21.
What is the InChIKey of CID 138984815?
The InChIKey is AEGHZFPHCOLRKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7O2/c9-8-7-4-2-1-3-6(7)5-10-8/h1-4,9H,5H2.
What are the key properties of CID 138984815?
CID 138984815 has a molecular weight of 135.14 g/mol, XLogP of 1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138984815 is sourced from PubChem (CID 138984815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).