C15H20O6 — CID 138990080
methyl 2-(1,3-dihydroxy-4a-methyl-5,8-dioxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)prop-2-enoate (PubChem CID 138990080) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is methyl 2-(1,3-dihydroxy-4a-methyl-5,8-dioxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)prop-2-enoate.
| Compound Name | methyl 2-(1,3-dihydroxy-4a-methyl-5,8-dioxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 138990080 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | methyl 2-(1,3-dihydroxy-4a-methyl-5,8-dioxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1C(O)CC2(C)C(=O)CCC(=O)C2C1O |
| InChI | InChI=1S/C15H20O6/c1-7(14(20)21-3)11-9(17)6-15(2)10(18)5-4-8(16)12(15)13(11)19/h9,11-13,17,19H,1,4-6H2,2-3H3 |
| InChIKey | WRZUILQUANXIGL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|