C18H42N3O13P — CID 139033864
tris[(3S,4R)-1-amino-2,3,4-trihydroxyhexyl] phosphate (PubChem CID 139033864) has the molecular formula C18H42N3O13P and a molecular weight of 539.52 g/mol. Its IUPAC name is tris[(3S,4R)-1-amino-2,3,4-trihydroxyhexyl] phosphate.
| Compound Name | tris[(3S,4R)-1-amino-2,3,4-trihydroxyhexyl] phosphate |
|---|---|
| PubChem CID | 139033864 |
| Molecular Formula | C18H42N3O13P |
| Molecular Weight | 539.52 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | tris[(3S,4R)-1-amino-2,3,4-trihydroxyhexyl] phosphate |
| SMILES | CC[C@@H](O)[C@H](O)C(O)C(N)OP(=O)(OC(N)C(O)[C@@H](O)[C@H](O)CC)OC(N)C(O)[C@@H](O)[C@H](O)CC |
| InChI | InChI=1S/C18H42N3O13P/c1-4-7(22)10(25)13(28)16(19)32-35(31,33-17(20)14(29)11(26)8(23)5-2)34-18(21)15(30)12(27)9(24)6-3/h7-18,22-30H,4-6,19-21H2,1-3H3/t7-,8-,9-,10+,11+,12+,13?,14?,15?,16?,17?,18?,35?/m1/s1 |
| InChIKey | VPQZATMYPYLCFN-DSXDPDBOSA-N |
| XLogP | -4.52 |
| TPSA | 304.89 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.52 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|