C16H26N2O4 — CID 139035293
4-O-tert-butyl 8-O-methyl (1S,2S,6S,8R)-4,10-diazatricyclo[6.3.0.02,6]undecane-4,8-dicarboxylate (PubChem CID 139035293) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 4-O-tert-butyl 8-O-methyl (1S,2S,6S,8R)-4,10-diazatricyclo[6.3.0.02,6]undecane-4,8-dicarboxylate.
| Compound Name | 4-O-tert-butyl 8-O-methyl (1S,2S,6S,8R)-4,10-diazatricyclo[6.3.0.02,6]undecane-4,8-dicarboxylate |
|---|---|
| PubChem CID | 139035293 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 4-O-tert-butyl 8-O-methyl (1S,2S,6S,8R)-4,10-diazatricyclo[6.3.0.02,6]undecane-4,8-dicarboxylate |
| SMILES | COC(=O)[C@@]12CNC[C@H]1[C@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C2 |
| InChI | InChI=1S/C16H26N2O4/c1-15(2,3)22-14(20)18-7-10-5-16(13(19)21-4)9-17-6-12(16)11(10)8-18/h10-12,17H,5-9H2,1-4H3/t10-,11+,12+,16+/m1/s1 |
| InChIKey | KEPLUTFWEJFEIK-YRORDHRNSA-N |
| XLogP | 1.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |