C22H26N2O7 — CID 139039016
[(3aS,5aR,6S,9aR,9bS)-3a,5a-dimethyl-1-oxo-2,3,4,5,6,7,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl] 3,5-dinitrobenzoate (PubChem CID 139039016) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is [(3aS,5aR,6S,9aR,9bS)-3a,5a-dimethyl-1-oxo-2,3,4,5,6,7,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl] 3,5-dinitrobenzoate.
| Compound Name | [(3aS,5aR,6S,9aR,9bS)-3a,5a-dimethyl-1-oxo-2,3,4,5,6,7,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 139039016 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [(3aS,5aR,6S,9aR,9bS)-3a,5a-dimethyl-1-oxo-2,3,4,5,6,7,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl] 3,5-dinitrobenzoate |
| SMILES | C[C@]12CCC(=O)[C@H]1[C@H]1CCC[C@H](OC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)[C@]1(C)CC2 |
| InChI | InChI=1S/C22H26N2O7/c1-21-7-6-17(25)19(21)16-4-3-5-18(22(16,2)9-8-21)31-20(26)13-10-14(23(27)28)12-15(11-13)24(29)30/h10-12,16,18-19H,3-9H2,1-2H3/t16-,18+,19-,21-,22-/m1/s1 |
| InChIKey | IUADJHNVTOSPCT-YICCBXQDSA-N |
| XLogP | 4.61 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|