C21H24N2O6 — CID 3125189
(3,5,5-trimethyl-8-methylidene-1,2,4,6,7,8a-hexahydroazulen-6-yl) 3,5-dinitrobenzoate (PubChem CID 3125189) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is (3,5,5-trimethyl-8-methylidene-1,2,4,6,7,8a-hexahydroazulen-6-yl) 3,5-dinitrobenzoate.
| Compound Name | (3,5,5-trimethyl-8-methylidene-1,2,4,6,7,8a-hexahydroazulen-6-yl) 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 3125189 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (3,5,5-trimethyl-8-methylidene-1,2,4,6,7,8a-hexahydroazulen-6-yl) 3,5-dinitrobenzoate |
| SMILES | C=C1CC(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C(C)(C)CC2=C(C)CCC12 |
| InChI | InChI=1S/C21H24N2O6/c1-12-5-6-17-13(2)7-19(21(3,4)11-18(12)17)29-20(24)14-8-15(22(25)26)10-16(9-14)23(27)28/h8-10,17,19H,2,5-7,11H2,1,3-4H3 |
| InChIKey | QXZCBRHBEXEZSO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|