C20H18N2O6 — CID 98558464
[(1S,6R,11R)-11-tricyclo[4.4.3.01,6]trideca-2,4,12-trienyl] 3,5-dinitrobenzoate (PubChem CID 98558464) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is [(1S,6R,11R)-11-tricyclo[4.4.3.01,6]trideca-2,4,12-trienyl] 3,5-dinitrobenzoate.
| Compound Name | [(1S,6R,11R)-11-tricyclo[4.4.3.01,6]trideca-2,4,12-trienyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 98558464 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [(1S,6R,11R)-11-tricyclo[4.4.3.01,6]trideca-2,4,12-trienyl] 3,5-dinitrobenzoate |
| SMILES | O=C(O[C@@H]1C=C[C@@]23C=CC=C[C@]12CCCC3)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18N2O6/c23-18(14-11-15(21(24)25)13-16(12-14)22(26)27)28-17-5-10-19-6-1-3-8-20(17,19)9-4-2-7-19/h1,3,5-6,8,10-13,17H,2,4,7,9H2/t17-,19+,20+/m1/s1 |
| InChIKey | GICOYOXIYCQZAO-HOJAQTOUSA-N |
| XLogP | 4.27 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|