C21H27NO4 — CID 163158434
4-[[(6R,8aS)-3,5,5-trimethyl-8-methylidene-1,2,4,6,7,8a-hexahydroazulen-6-yl]oxycarbonyl]-N-hydroxybenzeneamine oxide (PubChem CID 163158434) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 4-[[(6R,8aS)-3,5,5-trimethyl-8-methylidene-1,2,4,6,7,8a-hexahydroazulen-6-yl]oxycarbonyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[[(6R,8aS)-3,5,5-trimethyl-8-methylidene-1,2,4,6,7,8a-hexahydroazulen-6-yl]oxycarbonyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163158434 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4-[[(6R,8aS)-3,5,5-trimethyl-8-methylidene-1,2,4,6,7,8a-hexahydroazulen-6-yl]oxycarbonyl]-N-hydroxybenzeneamine oxide |
| SMILES | C=C1C[C@@H](OC(=O)c2ccc([NH+]([O-])O)cc2)C(C)(C)CC2=C(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H27NO4/c1-13-5-10-17-14(2)11-19(21(3,4)12-18(13)17)26-20(23)15-6-8-16(9-7-15)22(24)25/h6-9,17,19,22,24H,2,5,10-12H2,1,3-4H3/t17-,19+/m0/s1 |
| InChIKey | QBFUWJORMPXBMH-PKOBYXMFSA-N |
| XLogP | 3.72 |
| TPSA | 74.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|