C22H28O3 — CID 162835218
[(1R)-2,2,9-trimethyl-5-methylidenecycloundeca-3,8-dien-1-yl] 4-hydroxybenzoate (PubChem CID 162835218) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is [(1R)-2,2,9-trimethyl-5-methylidenecycloundeca-3,8-dien-1-yl] 4-hydroxybenzoate.
| Compound Name | [(1R)-2,2,9-trimethyl-5-methylidenecycloundeca-3,8-dien-1-yl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 162835218 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [(1R)-2,2,9-trimethyl-5-methylidenecycloundeca-3,8-dien-1-yl] 4-hydroxybenzoate |
| SMILES | C=C1C=CC(C)(C)[C@H](OC(=O)c2ccc(O)cc2)CCC(C)=CCC1 |
| InChI | InChI=1S/C22H28O3/c1-16-6-5-7-17(2)14-15-22(3,4)20(13-8-16)25-21(24)18-9-11-19(23)12-10-18/h6,9-12,14-15,20,23H,2,5,7-8,13H2,1,3-4H3/t20-/m1/s1 |
| InChIKey | KRXQZBVXWPNPBU-HXUWFJFHSA-N |
| XLogP | 5.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|