C25H22N2O3 — CID 139040622
(4S)-4-butyl-3-(4-nitrophenyl)spiro[4H-1,2-oxazole-5,9'-fluorene] (PubChem CID 139040622) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is (4S)-4-butyl-3-(4-nitrophenyl)spiro[4H-1,2-oxazole-5,9'-fluorene].
| Compound Name | (4S)-4-butyl-3-(4-nitrophenyl)spiro[4H-1,2-oxazole-5,9'-fluorene] |
|---|---|
| PubChem CID | 139040622 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (4S)-4-butyl-3-(4-nitrophenyl)spiro[4H-1,2-oxazole-5,9'-fluorene] |
| SMILES | CCCC[C@H]1C(c2ccc([N+](=O)[O-])cc2)=NOC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C25H22N2O3/c1-2-3-10-23-24(17-13-15-18(16-14-17)27(28)29)26-30-25(23)21-11-6-4-8-19(21)20-9-5-7-12-22(20)25/h4-9,11-16,23H,2-3,10H2,1H3/t23-/m0/s1 |
| InChIKey | YEUVFAOXDRVXLG-QHCPKHFHSA-N |
| XLogP | 6.06 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|