C16H19NO4 — CID 102071404
(4R,5S)-4-butyl-4-methyl-3-methylidene-5-(4-nitrophenyl)oxolan-2-one (PubChem CID 102071404) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (4R,5S)-4-butyl-4-methyl-3-methylidene-5-(4-nitrophenyl)oxolan-2-one.
| Compound Name | (4R,5S)-4-butyl-4-methyl-3-methylidene-5-(4-nitrophenyl)oxolan-2-one |
|---|---|
| PubChem CID | 102071404 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (4R,5S)-4-butyl-4-methyl-3-methylidene-5-(4-nitrophenyl)oxolan-2-one |
| SMILES | C=C1C(=O)O[C@@H](c2ccc([N+](=O)[O-])cc2)[C@]1(C)CCCC |
| InChI | InChI=1S/C16H19NO4/c1-4-5-10-16(3)11(2)15(18)21-14(16)12-6-8-13(9-7-12)17(19)20/h6-9,14H,2,4-5,10H2,1,3H3/t14-,16+/m0/s1 |
| InChIKey | NHKMLQNRZXMOHG-GOEBONIOSA-N |
| XLogP | 3.95 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|