C17H19NO5 — CID 57327576
(4S,6R)-5,5-dimethyl-3-methylidene-6-(4-nitrophenyl)-4-(2-oxopropyl)oxan-2-one (PubChem CID 57327576) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is (4S,6R)-5,5-dimethyl-3-methylidene-6-(4-nitrophenyl)-4-(2-oxopropyl)oxan-2-one.
| Compound Name | (4S,6R)-5,5-dimethyl-3-methylidene-6-(4-nitrophenyl)-4-(2-oxopropyl)oxan-2-one |
|---|---|
| PubChem CID | 57327576 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (4S,6R)-5,5-dimethyl-3-methylidene-6-(4-nitrophenyl)-4-(2-oxopropyl)oxan-2-one |
| SMILES | C=C1C(=O)O[C@@H](c2ccc([N+](=O)[O-])cc2)C(C)(C)[C@@H]1CC(C)=O |
| InChI | InChI=1S/C17H19NO5/c1-10(19)9-14-11(2)16(20)23-15(17(14,3)4)12-5-7-13(8-6-12)18(21)22/h5-8,14-15H,2,9H2,1,3-4H3/t14-,15+/m1/s1 |
| InChIKey | QXZICLXNUQRYLF-CABCVRRESA-N |
| XLogP | 3.37 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|