About cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium
cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium (PubChem CID 139042305) has the molecular formula C8H9N5O2
and a molecular weight of 207.19 g/mol. Its IUPAC name is cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium.
Molecular Properties
| Compound Name | cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium |
| PubChem CID | 139042305 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium |
| SMILES | C#CCn1cc[n+](C)c1.N#C[N-][N+](=O)[O-] |
| InChI | InChI=1S/C7H9N2.CN3O2/c1-3-4-9-6-5-8(2)7-9;2-1-3-4(5)6/h1,5-7H,4H2,2H3;/q+1;-1 |
| InChIKey | RROJUPBDUMHDNZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 89.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium?
The IUPAC name of cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium (CID 139042305) is cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium.
What is the SMILES notation for cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium?
The canonical SMILES for cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium is C#CCn1cc[n+](C)c1.N#C[N-][N+](=O)[O-].
What is the InChIKey of cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium?
The InChIKey is RROJUPBDUMHDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N2.CN3O2/c1-3-4-9-6-5-8(2)7-9;2-1-3-4(5)6/h1,5-7H,4H2,2H3;/q+1;-1.
What are the key properties of cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium?
cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium has a molecular weight of 207.19 g/mol, XLogP of -0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyano(nitro)azanide;1-methyl-3-prop-2-ynylimidazol-1-ium is sourced from PubChem (CID 139042305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).