C22H20N2O3 — CID 139045720
benzyl 2-[(5S)-3-methyl-6-oxo-5,7-dihydropyrrolo[1,2-d][1,4]benzodiazepin-5-yl]acetate (PubChem CID 139045720) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is benzyl 2-[(5S)-3-methyl-6-oxo-5,7-dihydropyrrolo[1,2-d][1,4]benzodiazepin-5-yl]acetate.
| Compound Name | benzyl 2-[(5S)-3-methyl-6-oxo-5,7-dihydropyrrolo[1,2-d][1,4]benzodiazepin-5-yl]acetate |
|---|---|
| PubChem CID | 139045720 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | benzyl 2-[(5S)-3-methyl-6-oxo-5,7-dihydropyrrolo[1,2-d][1,4]benzodiazepin-5-yl]acetate |
| SMILES | Cc1ccc2n1[C@@H](CC(=O)OCc1ccccc1)C(=O)Nc1ccccc1-2 |
| InChI | InChI=1S/C22H20N2O3/c1-15-11-12-19-17-9-5-6-10-18(17)23-22(26)20(24(15)19)13-21(25)27-14-16-7-3-2-4-8-16/h2-12,20H,13-14H2,1H3,(H,23,26)/t20-/m0/s1 |
| InChIKey | WWEXKHSPSYZGFZ-FQEVSTJZSA-N |
| XLogP | 4.09 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|