C28H40O6 — CID 139048929
(1R,2R,6S,9S,10S,13R)-9,13-dimethyl-3,14-dioxatetracyclo[8.4.0.01,13.02,6]tetradecan-4-one (PubChem CID 139048929) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is (1R,2R,6S,9S,10S,13R)-9,13-dimethyl-3,14-dioxatetracyclo[8.4.0.01,13.02,6]tetradecan-4-one.
| Compound Name | (1R,2R,6S,9S,10S,13R)-9,13-dimethyl-3,14-dioxatetracyclo[8.4.0.01,13.02,6]tetradecan-4-one |
|---|---|
| PubChem CID | 139048929 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (1R,2R,6S,9S,10S,13R)-9,13-dimethyl-3,14-dioxatetracyclo[8.4.0.01,13.02,6]tetradecan-4-one |
| SMILES | C[C@H]1CC[C@H]2CC(=O)O[C@H]2[C@@]23O[C@]2(C)CC[C@@H]13.C[C@H]1CC[C@H]2CC(=O)O[C@H]2[C@@]23O[C@]2(C)CC[C@@H]13 |
| InChI | InChI=1S/2C14H20O3/c2*1-8-3-4-9-7-11(15)16-12(9)14-10(8)5-6-13(14,2)17-14/h2*8-10,12H,3-7H2,1-2H3/t2*8-,9-,10-,12+,13+,14+/m00/s1 |
| InChIKey | NVBYENMGXBBFPS-BQAOGQRTSA-N |
| XLogP | 4.57 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|