C21H23N3O3 — CID 139050184
methyl (9S,10E,14R)-2-oxo-10-(phenylhydrazinylidene)-1-azatricyclo[7.4.1.05,14]tetradeca-3,5-diene-9-carboxylate (PubChem CID 139050184) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is methyl (9S,10E,14R)-2-oxo-10-(phenylhydrazinylidene)-1-azatricyclo[7.4.1.05,14]tetradeca-3,5-diene-9-carboxylate.
| Compound Name | methyl (9S,10E,14R)-2-oxo-10-(phenylhydrazinylidene)-1-azatricyclo[7.4.1.05,14]tetradeca-3,5-diene-9-carboxylate |
|---|---|
| PubChem CID | 139050184 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | methyl (9S,10E,14R)-2-oxo-10-(phenylhydrazinylidene)-1-azatricyclo[7.4.1.05,14]tetradeca-3,5-diene-9-carboxylate |
| SMILES | COC(=O)[C@]12CCC=C3C=CC(=O)N(CCC/C1=N\Nc1ccccc1)[C@H]32 |
| InChI | InChI=1S/C21H23N3O3/c1-27-20(26)21-13-5-7-15-11-12-18(25)24(19(15)21)14-6-10-17(21)23-22-16-8-3-2-4-9-16/h2-4,7-9,11-12,19,22H,5-6,10,13-14H2,1H3/b23-17+/t19-,21-/m1/s1 |
| InChIKey | JCERBFIKKIOEMW-ALOXWWKMSA-N |
| XLogP | 2.89 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|