C28H28N2O2 — CID 177493335
methyl (1S,21R)-3-benzyl-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,15,17-hexaene-1-carboxylate (PubChem CID 177493335) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is methyl (1S,21R)-3-benzyl-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,15,17-hexaene-1-carboxylate.
| Compound Name | methyl (1S,21R)-3-benzyl-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,15,17-hexaene-1-carboxylate |
|---|---|
| PubChem CID | 177493335 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | methyl (1S,21R)-3-benzyl-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,15,17-hexaene-1-carboxylate |
| SMILES | COC(=O)[C@]12CCC=C3C=CCN(CCc4c1n(Cc1ccccc1)c1ccccc41)[C@H]32 |
| InChI | InChI=1S/C28H28N2O2/c1-32-27(31)28-16-7-11-21-12-8-17-29(25(21)28)18-15-23-22-13-5-6-14-24(22)30(26(23)28)19-20-9-3-2-4-10-20/h2-6,8-14,25H,7,15-19H2,1H3/t25-,28+/m1/s1 |
| InChIKey | VOCGSFQNWYEGJC-NAKRPHOHSA-N |
| XLogP | 4.62 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |