C11H19NSi-2 — CID 139051064
[tert-butyl(dimethyl)silyl]-cyclopenta-1,3-dien-1-ylazanide (PubChem CID 139051064) has the molecular formula C11H19NSi-2 and a molecular weight of 193.37 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl]-cyclopenta-1,3-dien-1-ylazanide.
| Compound Name | [tert-butyl(dimethyl)silyl]-cyclopenta-1,3-dien-1-ylazanide |
|---|---|
| PubChem CID | 139051064 |
| Molecular Formula | C11H19NSi-2 |
| Molecular Weight | 193.37 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | [tert-butyl(dimethyl)silyl]-cyclopenta-1,3-dien-1-ylazanide |
| SMILES | CC(C)(C)[Si](C)(C)[N-]c1ccc[cH-]1 |
| InChI | InChI=1S/C11H19NSi/c1-11(2,3)13(4,5)12-10-8-6-7-9-10/h6-9H,1-5H3/q-2 |
| InChIKey | OIWJYNQVNUIEER-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|