C24H16F6I2N2O6S2 — CID 139052222
3-iodo-4-[2-[3-[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]phenyl]ethynyl]-1-methylpyridin-1-ium;bis(trifluoromethanesulfonate) (PubChem CID 139052222) has the molecular formula C24H16F6I2N2O6S2 and a molecular weight of 860.33 g/mol. Its IUPAC name is 3-iodo-4-[2-[3-[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]phenyl]ethynyl]-1-methylpyridin-1-ium;bis(trifluoromethanesulfonate).
| Compound Name | 3-iodo-4-[2-[3-[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]phenyl]ethynyl]-1-methylpyridin-1-ium;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139052222 |
| Molecular Formula | C24H16F6I2N2O6S2 |
| Molecular Weight | 860.33 g/mol |
| Exact Mass | 859.84 |
| IUPAC Name | 3-iodo-4-[2-[3-[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]phenyl]ethynyl]-1-methylpyridin-1-ium;bis(trifluoromethanesulfonate) |
| SMILES | C[n+]1ccc(C#Cc2cccc(C#Cc3cc[n+](C)cc3I)c2)c(I)c1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C22H16I2N2.2CHF3O3S/c1-25-12-10-19(21(23)15-25)8-6-17-4-3-5-18(14-17)7-9-20-11-13-26(2)16-22(20)24;2*2-1(3,4)8(5,6)7/h3-5,10-16H,1-2H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | MDNMDQBDCPJSHI-UHFFFAOYSA-L |
| XLogP | 3.45 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|