C24H16F7I2N3O6S2 — CID 139052220
4-fluoro-2,6-bis[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]aniline;bis(trifluoromethanesulfonate) (PubChem CID 139052220) has the molecular formula C24H16F7I2N3O6S2 and a molecular weight of 893.33 g/mol. Its IUPAC name is 4-fluoro-2,6-bis[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]aniline;bis(trifluoromethanesulfonate).
| Compound Name | 4-fluoro-2,6-bis[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]aniline;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139052220 |
| Molecular Formula | C24H16F7I2N3O6S2 |
| Molecular Weight | 893.33 g/mol |
| Exact Mass | 892.85 |
| IUPAC Name | 4-fluoro-2,6-bis[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]aniline;bis(trifluoromethanesulfonate) |
| SMILES | C[n+]1ccc(C#Cc2cc(F)cc(C#Cc3cc[n+](C)cc3I)c2N)c(I)c1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C22H15FI2N3.2CHF3O3S/c1-27-9-7-15(20(24)13-27)3-5-17-11-19(23)12-18(22(17)26)6-4-16-8-10-28(2)14-21(16)25;2*2-1(3,4)8(5,6)7/h7-14,26H,1-2H3;2*(H,5,6,7)/q+1;;/p-1 |
| InChIKey | FKTLSTDPMORYKQ-UHFFFAOYSA-M |
| XLogP | 3.17 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|