C43H34Cl2N4O4 — CID 139057976
dichloromethane;bis((4S)-4-hydroperoxy-2,4,5-triphenylimidazole) (PubChem CID 139057976) has the molecular formula C43H34Cl2N4O4 and a molecular weight of 741.68 g/mol. Its IUPAC name is dichloromethane;bis((4S)-4-hydroperoxy-2,4,5-triphenylimidazole).
| Compound Name | dichloromethane;bis((4S)-4-hydroperoxy-2,4,5-triphenylimidazole) |
|---|---|
| PubChem CID | 139057976 |
| Molecular Formula | C43H34Cl2N4O4 |
| Molecular Weight | 741.68 g/mol |
| Exact Mass | 740.20 |
| IUPAC Name | dichloromethane;bis((4S)-4-hydroperoxy-2,4,5-triphenylimidazole) |
| SMILES | ClCCl.OO[C@]1(c2ccccc2)N=C(c2ccccc2)N=C1c1ccccc1.OO[C@]1(c2ccccc2)N=C(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/2C21H16N2O2.CH2Cl2/c2*24-25-21(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)22-20(23-21)17-12-6-2-7-13-17;2-1-3/h2*1-15,24H;1H2/t2*21-;/m00./s1 |
| InChIKey | PICKNHJBCOJVBW-HRQBZJEISA-N |
| XLogP | 9.98 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.68 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|