C15H11Cl2NO2 — CID 12905786
4,4-dichloro-3,5-diphenyl-1,2-oxazol-5-ol (PubChem CID 12905786) has the molecular formula C15H11Cl2NO2 and a molecular weight of 308.16 g/mol. Its IUPAC name is 4,4-dichloro-3,5-diphenyl-1,2-oxazol-5-ol.
| Compound Name | 4,4-dichloro-3,5-diphenyl-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 12905786 |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 4,4-dichloro-3,5-diphenyl-1,2-oxazol-5-ol |
| SMILES | OC1(c2ccccc2)ON=C(c2ccccc2)C1(Cl)Cl |
| InChI | InChI=1S/C15H11Cl2NO2/c16-14(17)13(11-7-3-1-4-8-11)18-20-15(14,19)12-9-5-2-6-10-12/h1-10,19H |
| InChIKey | FTRQKNOKNVOAOI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|